
CAS 885229-40-3
:1-(2-Methoxy-5-thiazolyl)ethanone
Description:
1-(2-Methoxy-5-thiazolyl)ethanone, identified by its CAS number 885229-40-3, is an organic compound characterized by its thiazole ring and methoxy group, which contribute to its unique chemical properties. The thiazole moiety is known for its heterocyclic structure, which can enhance biological activity and reactivity. This compound typically exhibits moderate polarity due to the presence of the methoxy group, influencing its solubility in various solvents. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, owing to the functional groups present. Additionally, compounds with thiazole rings are often studied for their potential pharmacological properties, including antimicrobial and anti-inflammatory activities. The presence of the ethanone functional group suggests that it may also exhibit ketone-like reactivity, making it a candidate for further chemical transformations. Overall, 1-(2-Methoxy-5-thiazolyl)ethanone is a compound of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C6H7NO2S
InChI:InChI=1S/C6H7NO2S/c1-4(8)5-3-7-6(9-2)10-5/h3H,1-2H3
InChI key:InChIKey=IMRWWVBKYRVNSG-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1SC(OC)=NC1
Synonyms:- 1-(2-Methoxy-1,3-thiazol-5-yl)ethan-1-one
- Ethanone, 1-(2-methoxy-5-thiazolyl)-
- 1-(2-Methoxy-5-thiazolyl)ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.