CAS 885266-50-2
:2-[2-Methyl-4-(phenylmethoxy)butyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[2-Methyl-4-(phenylmethoxy)butyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 885266-50-2, is a synthetic organic compound characterized by its isoindole structure, which features a bicyclic system comprising a benzene ring fused to a five-membered nitrogen-containing ring. This compound exhibits a complex molecular architecture, incorporating a butyl side chain with a methyl group and a phenylmethoxy substituent, which contributes to its potential biological activity. The presence of the isoindole moiety suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on the functional groups present, influencing its applications in pharmaceuticals or as a research chemical. The compound's synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of its structure. Overall, this compound represents a unique class of isoindole derivatives that may exhibit diverse pharmacological properties, warranting further investigation into its potential uses.
Formula:C20H21NO3
InChI:InChI=1S/C20H21NO3/c1-15(11-12-24-14-16-7-3-2-4-8-16)13-21-19(22)17-9-5-6-10-18(17)20(21)23/h2-10,15H,11-14H2,1H3
InChI key:InChIKey=KANPWWMRBFPDHL-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC(CCOCC3=CC=CC=C3)C)=CC=CC2
Synonyms:- 2-[2-Methyl-4-(phenylmethoxy)butyl]-1H-isoindole-1,3(2H)-dione
- 1H-Isoindole-1,3(2H)-dione, 2-[2-methyl-4-(phenylmethoxy)butyl]-
- 2-(4-BENZYLOXY-2-METHYLBUTYL)PHTHALIMIDE
- 2-(4-(Benzyloxy)-2-methylbutyl)isoindoline-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
