CAS 885266-54-6

Methyl 4-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzoate

Description:

Methyl 4-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzoate, with the CAS number 885266-54-6, is a chemical compound characterized by its complex structure, which includes a benzoate moiety and a fluorenylmethoxycarbonyl (Fmoc) protecting group. This compound is typically used in peptide synthesis as a protective group for amino acids, facilitating the selective modification of amino functionalities. It is a white to off-white solid that is soluble in organic solvents such as dichloromethane and dimethylformamide, but generally insoluble in water. The presence of the Fmoc group allows for easy removal under basic conditions, making it a valuable tool in organic synthesis. Additionally, the compound's structure contributes to its stability and reactivity, which are essential for its application in various chemical reactions, particularly in the field of medicinal chemistry and biochemistry. Proper handling and storage conditions are necessary to maintain its integrity and effectiveness in synthetic applications.

Formula: C₂₄H₂₁NO₄

InChI: InChI=1S/C24H21NO4/c1-28-23(26)17-12-10-16(11-13-17)14-25-24(27)29-15-22-20-8-4-2-6-18(20)19-7-3-5-9-21(19)22/h2-13,22H,14-15H2,1H3,(H,25,27)

InChI key: InChIKey=OBCKJSMKDSHPPN-UHFFFAOYSA-N

SMILES: C(OC(NCC1=CC=C(C(OC)=O)C=C1)=O)C2C=3C(C=4C2=CC=CC4)=CC=CC3

Synonyms:

• Benzoic acid, 4-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]-, methyl ester
• Methyl 4-[[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]methyl]benzoate