CAS 885266-58-0
:1,1-Dimethylethyl N-[1-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-2-(methylthio)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[1-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-2-(methylthio)ethyl]carbamate, identified by CAS number 885266-58-0, is a synthetic organic compound characterized by its complex molecular structure. It features a carbamate functional group, which is indicative of its potential use in various applications, including as a pesticide or herbicide. The presence of a dimethyl group suggests steric hindrance, which may influence its reactivity and interaction with biological systems. The isoindole moiety contributes to its stability and may enhance its biological activity. Additionally, the methylthio group can impart specific chemical properties, such as increased lipophilicity, which can affect its absorption and distribution in living organisms. Overall, this compound's unique structural features suggest potential utility in agricultural chemistry, though specific biological activity and environmental impact would require further investigation through empirical studies.
Formula:C17H22N2O4S
InChI:InChI=1S/C17H22N2O4S/c1-17(2,3)23-16(22)18-11(10-24-4)9-19-14(20)12-7-5-6-8-13(12)15(19)21/h5-8,11H,9-10H2,1-4H3,(H,18,22)
InChI key:InChIKey=RNWWBBWIAGBZOO-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CC(NC(OC(C)(C)C)=O)CSC)=CC=CC2
Synonyms:- Carbamic acid, N-[1-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-2-(methylthio)ethyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl N-[1-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-2-(methylthio)ethyl]carbamate
- Carbamic acid, [1-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-2-(methylthio)ethyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.