CAS 885266-65-9

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1H-indole-1-propanoic acid

Description:

4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1H-indole-1-propanoic acid, with the CAS number 885266-65-9, is a chemical compound characterized by its complex structure, which includes an indole ring, a propanoic acid moiety, and a dimethylethoxycarbonyl group. This compound is typically classified as an amino acid derivative due to the presence of both an amino group and a carboxylic acid group, which are essential for its potential biological activity. The indole structure contributes to its aromatic properties and may influence its interactions in biological systems. The dimethylethoxycarbonyl group serves as a protective or modifying group, which can enhance the compound's stability and solubility. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in drug design and development, due to their ability to mimic natural amino acids and interact with biological targets. Overall, the unique combination of functional groups in this compound suggests potential utility in medicinal chemistry and biochemistry.

Formula: C₁₆H₂₀N₂O₄

InChI: InChI=1S/C16H20N2O4/c1-16(2,3)22-15(21)17-12-5-4-6-13-11(12)7-9-18(13)10-8-14(19)20/h4-7,9H,8,10H2,1-3H3,(H,17,21)(H,19,20)

InChI key: InChIKey=GJTJHFFVBIKJSZ-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1=C2C(N(CCC(O)=O)C=C2)=CC=C1

Synonyms:

• 1H-Indole-1-propanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-
• 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-1H-indole-1-propanoic acid

3-[4-[(tert-Butoxycarbonyl)amino]-1H-indol-1-yl]propanoic acid

CAS: 885266-65-9

Formula: C₁₆H₂₀N₂O₄

Purity: 98.0%

Molecular weight: 304.346

Ref: 10-F095549