CAS 885266-79-5
:7-Nitro-1H-indol-3-yl thiocyanate
Description:
7-Nitro-1H-indol-3-yl thiocyanate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a nitro group at the 7-position and a thiocyanate group at the 3-position contributes to its unique reactivity and potential applications in various fields, including medicinal chemistry and material science. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its reactivity can be influenced by the electron-withdrawing nature of the nitro group, which can affect its interactions with biological targets or other chemical species. Additionally, the thiocyanate group can participate in nucleophilic substitution reactions, making it a versatile building block in synthetic chemistry. Safety data should be consulted for handling, as compounds with nitro and thiocyanate functionalities may pose health risks. Overall, 7-Nitro-1H-indol-3-yl thiocyanate is of interest for its potential biological activity and utility in chemical synthesis.
Formula:C9H5N3O2S
InChI:InChI=1S/C9H5N3O2S/c10-5-15-8-4-11-9-6(8)2-1-3-7(9)12(13)14/h1-4,11H
InChI key:InChIKey=IHGLKSNUTFHIAG-UHFFFAOYSA-N
SMILES:S(C#N)C=1C=2C(=C(N(=O)=O)C=CC2)NC1
Synonyms:- 7-Nitro-1H-indol-3-yl thiocyanate
- [(7-Nitro-1H-indol-3-yl)sulfanyl]formonitrile
- Thiocyanic acid, 7-nitro-1H-indol-3-yl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
