CAS 885266-80-8

1-(2-Amino-2-oxoethyl)-1H-indole-6-carboxylic acid

Description:

1-(2-Amino-2-oxoethyl)-1H-indole-6-carboxylic acid, identified by its CAS number 885266-80-8, is a chemical compound that features an indole ring, which is a bicyclic structure consisting of a benzene fused to a pyrrole. This compound contains an amino group and a carboxylic acid functional group, contributing to its potential as a biologically active molecule. The presence of the 2-amino-2-oxoethyl side chain suggests that it may participate in various biochemical interactions, possibly influencing enzyme activity or acting as a precursor in metabolic pathways. Its structural characteristics may also indicate solubility in polar solvents, and it could exhibit properties such as acidity due to the carboxylic acid group. Additionally, compounds with similar structures are often investigated for their pharmacological properties, including antimicrobial or anticancer activities. However, specific biological activities and applications would require further empirical research to elucidate its potential uses in medicinal chemistry or biochemistry.

Formula: C₁₁H₁₀N₂O₃

InChI: InChI=1S/C11H10N2O3/c12-10(14)6-13-4-3-7-1-2-8(11(15)16)5-9(7)13/h1-5H,6H2,(H2,12,14)(H,15,16)

InChI key: InChIKey=SLQGXSJFDQXMTN-UHFFFAOYSA-N

SMILES: C(C(N)=O)N1C=2C(C=C1)=CC=C(C(O)=O)C2

Synonyms:

• 1-(2-Amino-2-oxoethyl)-1H-indole-6-carboxylic acid
• 1H-Indole-6-carboxylic acid, 1-(2-amino-2-oxoethyl)-