CAS 885267-01-6
:N-Hydroxy-3-methylenecyclobutanecarboximidamide
Description:
N-Hydroxy-3-methylenecyclobutanecarboximidamide is a chemical compound characterized by its unique structural features, including a cyclobutane ring and a hydroxylamine functional group. This compound typically exhibits properties associated with both amides and hydroxylamines, which may influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The presence of the methylene group contributes to its molecular flexibility, while the carboximidamide moiety may impart specific biological activities or interactions. As a relatively specialized compound, it may not be widely studied, but its structure suggests potential utility in various chemical reactions, such as nucleophilic substitutions or as a precursor in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, particularly those with reactive functional groups. Further research would be necessary to fully elucidate its properties, reactivity, and potential applications in various fields.
Formula:C6H10N2O
InChI:InChI=1S/C6H10N2O/c1-4-2-5(3-4)6(7)8-9/h5,9H,1-3H2,(H2,7,8)
InChI key:InChIKey=YTBCOSSJXCVEMI-UHFFFAOYSA-N
SMILES:C(NO)(=N)C1CC(=C)C1
Synonyms:- N-Hydroxy-3-methylenecyclobutanecarboximidamide
- Cyclobutanecarboximidamide, N-hydroxy-3-methylene-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
