CAS 885267-02-7
:1-Bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene
Description:
1-Bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene is an organic compound characterized by the presence of a bromine atom and a tetrafluorocyclobutyl group attached to a benzene ring. This compound features a bromine substituent at the para position relative to the cyclobutyl group, which is fully fluorinated, enhancing its chemical stability and altering its physical properties. The presence of multiple fluorine atoms contributes to its hydrophobic nature and can influence its reactivity, making it less prone to nucleophilic attack. The compound is likely to exhibit unique electronic properties due to the electron-withdrawing effects of the fluorine atoms, which can affect its behavior in various chemical reactions. Additionally, the bulky tetrafluorocyclobutyl group may impart steric hindrance, influencing the compound's interactions with other molecules. Overall, 1-Bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene is of interest in materials science and organic synthesis, particularly in the development of fluorinated compounds with specific functional properties.
Formula:C10H7BrF4
InChI:InChI=1S/C10H7BrF4/c11-7-3-1-6(2-4-7)8-5-9(12,13)10(8,14)15/h1-4,8H,5H2
InChI key:InChIKey=KDNLQJIMDWXOHJ-UHFFFAOYSA-N
SMILES:FC1(F)C(CC1(F)F)C2=CC=C(Br)C=C2
Synonyms:- 1-Bromo-4-(2,2,3,3-tetrafluorocyclobutyl)benzene
- Benzene, 1-bromo-4-(2,2,3,3-tetrafluorocyclobutyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.