CAS 885267-09-4

1-Bromo-3-[(3,3,3-trifluoropropyl)thio]benzene

Description:

1-Bromo-3-[(3,3,3-trifluoropropyl)thio]benzene is an organobromine compound characterized by the presence of a bromine atom and a thioether functional group attached to a benzene ring. The molecular structure features a bromine substituent at the 1-position and a thioether group at the 3-position of the benzene ring, with a trifluoropropyl chain linked to the sulfur atom. This compound is likely to exhibit properties typical of both aromatic compounds and organofluorine compounds, such as stability and potential hydrophobicity due to the trifluoropropyl group. The presence of the bromine atom may impart reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the trifluoropropyl group can enhance lipophilicity, which may influence its behavior in biological systems and its applications in materials science or pharmaceuticals. Overall, 1-Bromo-3-[(3,3,3-trifluoropropyl)thio]benzene is a compound of interest in synthetic chemistry and may have potential applications in various fields.

Formula: C₉H₈BrF₃S

InChI: InChI=1S/C9H8BrF3S/c10-7-2-1-3-8(6-7)14-5-4-9(11,12)13/h1-3,6H,4-5H2

InChI key: InChIKey=IMHSMEOIMGDBKX-UHFFFAOYSA-N

SMILES: S(CCC(F)(F)F)C1=CC(Br)=CC=C1

Synonyms:

• Benzene, 1-bromo-3-[(3,3,3-trifluoropropyl)thio]-
• 1-Bromo-3-[(3,3,3-trifluoropropyl)thio]benzene

3,3,3-Trifluoropropyl 3-bromophenyl sulfide

CAS: 885267-09-4

3,3,3-Trifluoropropyl 3-bromophenyl sulfide

Molecular weight: 285.12403g/mol

Ref: 54-PC107217

3,3,3-Trifluoropropyl 3-bromophenyl sulfide

CAS: 885267-09-4

Formula: C₉H₈BrF₃S

Purity: 99.0%

Molecular weight: 285.12

Ref: 10-F094780