CAS 885267-10-7
:1-Bromo-3-[(4-fluorobutyl)thio]benzene
Description:
1-Bromo-3-[(4-fluorobutyl)thio]benzene is an organic compound characterized by its aromatic structure, which includes a bromine atom and a thioether functional group. The presence of the bromine atom at the meta position relative to the thioether group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The thioether group, derived from a butyl chain with a fluorine substituent, enhances the compound's lipophilicity and may influence its biological activity. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and temperature. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence. Overall, 1-Bromo-3-[(4-fluorobutyl)thio]benzene represents a versatile compound with unique properties stemming from its functional groups.
Formula:C10H12BrFS
InChI:InChI=1S/C10H12BrFS/c11-9-4-3-5-10(8-9)13-7-2-1-6-12/h3-5,8H,1-2,6-7H2
InChI key:InChIKey=JOUZZVMTLDTFTJ-UHFFFAOYSA-N
SMILES:S(CCCCF)C1=CC(Br)=CC=C1
Synonyms:- Benzene, 1-bromo-3-[(4-fluorobutyl)thio]-
- 1-Bromo-3-[(4-fluorobutyl)thio]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
