CAS 885267-14-1

(6-chloropyridin-2-yl)acetic acid

Description:

(6-Chloropyridin-2-yl)acetic acid is a chemical compound characterized by its pyridine ring structure, which features a chlorine substituent at the 6-position and an acetic acid functional group attached at the 2-position. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group. It exhibits properties typical of both pyridine derivatives and carboxylic acids, including potential acidity and the ability to participate in hydrogen bonding. The chlorine atom can influence the compound's reactivity and biological activity, making it of interest in medicinal chemistry and agrochemical applications. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with enhanced properties. As with many chemical substances, safety precautions should be taken when handling (6-chloropyridin-2-yl)acetic acid, as it may pose health risks or environmental hazards.

Formula: C₇H₆ClNO₂

InChI: InChI=1/C7H6ClNO2/c8-6-3-1-2-5(9-6)4-7(10)11/h1-3H,4H2,(H,10,11)

SMILES: c1cc(CC(=O)O)nc(c1)Cl

Synonyms:

• 2-(6-Chloropyridin-2-Yl)Acetic Acid
• 2-Pyridineacetic Acid, 6-Chloro-
• (6-Chloropyridin-2-yl)acetic acid

(6-chloropyridin-2-yl)acetic acid

CAS: 885267-14-1

Formula: C₇H₆ClNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.5810

Ref: IN-DA00474V

2-(6-Chloropyridin-2-yl)acetic acid

CAS: 885267-14-1

2-(6-Chloropyridin-2-yl)acetic acid

Purity: 97%

Molecular weight: 171.58g/mol

Ref: 54-OR76277

2-(6-Chloropyridin-2-yl)acetic acid

CAS: 885267-14-1

Formula: C₇H₆ClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 171.58

Ref: 10-F215296