
CAS 885267-42-5
:2-Fluoro-3,6-dimethylpyridine
Description:
2-Fluoro-3,6-dimethylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a fluorine atom and two methyl groups. The presence of the fluorine atom at the 2-position and methyl groups at the 3 and 6 positions contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. This compound typically exhibits a pale yellow to colorless liquid appearance and has a distinct aromatic odor. It is soluble in organic solvents, which makes it useful in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the fluorine atom can enhance the biological activity of derivatives, making it of interest in medicinal chemistry. Additionally, 2-fluoro-3,6-dimethylpyridine may participate in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the fluorine atom, influencing its reactivity and interaction with other chemical species. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H8FN
InChI:InChI=1S/C7H8FN/c1-5-3-4-6(2)9-7(5)8/h3-4H,1-2H3
InChI key:InChIKey=GVBXHTCVVDWREE-UHFFFAOYSA-N
SMILES:FC1=C(C)C=CC(C)=N1
Synonyms:- Pyridine, 2-fluoro-3,6-dimethyl-
- 2-Fluoro-3,6-dimethylpyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.