CAS 885267-44-7
:1-(5-Bromo-3-methyl-2-pyridinyl)-4-methylpiperazine
Description:
1-(5-Bromo-3-methyl-2-pyridinyl)-4-methylpiperazine is a chemical compound characterized by its unique structure, which includes a piperazine ring substituted with a pyridine moiety. The presence of a bromine atom at the 5-position of the pyridine ring and a methyl group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in its ring structures. It may exhibit properties such as solubility in polar solvents, and its molecular interactions can be influenced by the presence of the bromine and methyl substituents. The compound is of interest in medicinal chemistry and pharmacology, potentially serving as a lead compound for the development of pharmaceuticals. Its specific applications and biological activities would depend on further research and characterization, including studies on its mechanism of action and efficacy in various biological systems.
Formula:C11H16BrN3
InChI:InChI=1S/C11H16BrN3/c1-9-7-10(12)8-13-11(9)15-5-3-14(2)4-6-15/h7-8H,3-6H2,1-2H3
InChI key:InChIKey=NHSUNJSCCDVYLK-UHFFFAOYSA-N
SMILES:CC1=C(N2CCN(C)CC2)N=CC(Br)=C1
Synonyms:- 1-(5-Bromo-3-methyl-2-pyridinyl)-4-methylpiperazine
- Piperazine, 1-(5-bromo-3-methyl-2-pyridinyl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
