CAS 885268-00-8
:2-Amino-5-(2-methylphenoxy)benzoic acid
Description:
2-Amino-5-(2-methylphenoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with an amino group and a 2-methylphenoxy group. This compound features a carboxylic acid functional group, contributing to its acidity and potential for hydrogen bonding. The presence of the amino group enhances its solubility in polar solvents and may participate in various chemical reactions, such as amide formation. The 2-methylphenoxy substituent introduces additional hydrophobic characteristics, influencing the compound's overall polarity and biological activity. This compound may exhibit properties relevant to pharmaceuticals or agrochemicals, given its structural features that can interact with biological systems. Its CAS number, 885268-00-8, allows for precise identification in chemical databases. Overall, 2-Amino-5-(2-methylphenoxy)benzoic acid is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.
Formula:C14H13NO3
InChI:InChI=1S/C14H13NO3/c1-9-4-2-3-5-13(9)18-10-6-7-12(15)11(8-10)14(16)17/h2-8H,15H2,1H3,(H,16,17)
InChI key:InChIKey=XJZGSKLLSIYBQF-UHFFFAOYSA-N
SMILES:O(C1=CC(C(O)=O)=C(N)C=C1)C2=C(C)C=CC=C2
Synonyms:- 2-Amino-5-(2-methylphenoxy)benzoic acid
- Benzoic acid, 2-amino-5-(2-methylphenoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
