CymitQuimica logo

CAS 885268-02-0

:

1(2H)-Naphthalenone,3,4-dihydro-5-(trifluoromethyl)-

Description:
1(2H)-Naphthalenone, 3,4-dihydro-5-(trifluoromethyl)-, identified by CAS number 885268-02-0, is a synthetic organic compound characterized by its naphthalene backbone with a ketone functional group and a trifluoromethyl substituent. This compound features a bicyclic structure, which contributes to its unique chemical properties, including potential reactivity and stability under various conditions. The trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in medicinal chemistry and material science. The presence of the dihydro group indicates that it is partially saturated, which may affect its electronic properties and reactivity compared to fully aromatic naphthalenones. This compound may exhibit interesting photophysical properties and could be utilized in various applications, including as a building block in organic synthesis or as a potential pharmaceutical agent. However, specific data regarding its solubility, melting point, and other physical properties would require further investigation or experimental determination.
Formula:C11H9F3O
InChI:InChI=1S/C11H9F3O/c12-11(13,14)9-5-1-4-8-7(9)3-2-6-10(8)15/h1,4-5H,2-3,6H2
InChI key:OHPGWVKTCNNPMH-UHFFFAOYSA-N
SMILES:C1CC2=C(C=CC=C2C(F)(F)F)C(=O)C1
Found 3 products.