CymitQuimica logo

CAS 885268-22-4

:

4-Amino-3′,4′-dichloro[1,1′-biphenyl]-3-carboxylic acid

Description:
4-Amino-3′,4′-dichloro[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by the presence of an amino group, carboxylic acid group, and dichloro substituents on a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, enhancing its stability and potential for various chemical interactions. The amino group (-NH2) contributes to its basicity and potential for forming hydrogen bonds, while the carboxylic acid group (-COOH) imparts acidic properties, allowing for proton donation in solution. The dichloro substituents introduce significant electronegativity, influencing the compound's reactivity and solubility. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its unique structure allows for potential applications in various fields, including materials science and medicinal chemistry. Proper handling and safety measures should be observed due to the presence of chlorine atoms, which can pose environmental and health risks.
Formula:C13H9Cl2NO2
InChI:InChI=1S/C13H9Cl2NO2/c14-10-3-1-8(6-11(10)15)7-2-4-12(16)9(5-7)13(17)18/h1-6H,16H2,(H,17,18)
InChI key:InChIKey=VCEZFLSMDHNSDI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1N)C2=CC(Cl)=C(Cl)C=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carboxylic acid, 4-amino-3′,4′-dichloro-
  • 4-Amino-3′,4′-dichloro[1,1′-biphenyl]-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.