CAS 885268-25-7
:1-(1-Methyl-1-buten-1-yl)cyclopropanamine
Description:
1-(1-Methyl-1-buten-1-yl)cyclopropanamine, identified by its CAS number 885268-25-7, is a chemical compound characterized by its unique structure that includes a cyclopropane ring and an alkenyl side chain. This compound features a cyclopropanamine moiety, which contributes to its potential reactivity and biological activity. The presence of the 1-methyl-1-butenyl group introduces unsaturation and steric effects, influencing its chemical properties and interactions. Typically, compounds of this nature may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The cyclopropane ring can impart strain, which may lead to distinctive reactivity patterns compared to more stable cyclic structures. Additionally, the amine functional group suggests potential for hydrogen bonding and interactions with biological targets. Overall, the characteristics of 1-(1-Methyl-1-buten-1-yl)cyclopropanamine make it a compound of interest for further study in various chemical and biological contexts.
Formula:C8H15N
InChI:InChI=1S/C8H15N/c1-3-4-7(2)8(9)5-6-8/h4H,3,5-6,9H2,1-2H3
InChI key:InChIKey=ZVGBDAYJDJKOAB-UHFFFAOYSA-N
SMILES:C(=CCC)(C)C1(N)CC1
Synonyms:- Cyclopropanamine, 1-(1-methyl-1-butenyl)-
- 1-(1-Methyl-1-buten-1-yl)cyclopropanamine
- Cyclopropanamine, 1-(1-methyl-1-buten-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
