CAS 885268-28-0

4-Amino-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

4-Amino-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an amino group (-NH2) and a carboxylic acid group (-COOH) contributes to its functionality, making it a potential candidate for various chemical reactions and applications in pharmaceuticals or agrochemicals. The trifluoromethyl group (-CF3) enhances its lipophilicity and can influence its biological activity, stability, and solubility. This compound is typically synthesized through multi-step organic reactions, and its properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions of synthesis and purification. As a chemical entity, it may exhibit interesting interactions in biological systems, making it a subject of interest in medicinal chemistry. Safety data and handling precautions should be considered, as with any chemical, to ensure proper laboratory practices.

Formula: C₁₄H₁₀F₃NO₂

InChI: InChI=1S/C14H10F3NO2/c15-14(16,17)10-3-1-2-8(6-10)9-4-5-12(18)11(7-9)13(19)20/h1-7H,18H2,(H,19,20)

InChI key: InChIKey=YMJPLCDPUVMMRH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=CC1N)C2=CC(C(F)(F)F)=CC=C2

Synonyms:

• 2-Amino-5-[3-(trifluoromethyl)phenyl]benzoic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4-amino-3′-(trifluoromethyl)-
• 4-Amino-3′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid