CAS 885268-33-7
:6-(4-Bromo-1-piperidinyl)-1,3,5-triazine-2,4-diamine
Description:
6-(4-Bromo-1-piperidinyl)-1,3,5-triazine-2,4-diamine is a chemical compound characterized by its triazine core, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features a piperidine ring substituted at one of the triazine positions with a bromine atom, enhancing its reactivity and potential biological activity. The presence of amino groups at the 2 and 4 positions of the triazine contributes to its ability to form hydrogen bonds, which can influence its solubility and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural motifs that can interact with various biological systems. Its CAS number, 885268-33-7, allows for easy identification in chemical databases and literature. Overall, the unique combination of a triazine framework with piperidine and bromine substituents suggests potential applications in drug discovery and development, particularly in targeting specific receptors or enzymes.
Formula:C8H13BrN6
InChI:InChI=1S/C8H13BrN6/c9-5-1-3-15(4-2-5)8-13-6(10)12-7(11)14-8/h5H,1-4H2,(H4,10,11,12,13,14)
InChI key:InChIKey=WTDDQWHPLHQWRQ-UHFFFAOYSA-N
SMILES:NC1=NC(=NC(N)=N1)N2CCC(Br)CC2
Synonyms:- 1,3,5-Triazine-2,4-diamine, 6-(4-bromo-1-piperidinyl)-
- 6-(4-Bromo-1-piperidinyl)-1,3,5-triazine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
