CymitQuimica logo

CAS 885268-49-5

:

4,4′-[5-Chloro-4-[(4-hydroxyphenyl)methyl]-1H-imidazole-1,2-diyl]bis[phenol]

Description:
4,4′-[5-Chloro-4-[(4-hydroxyphenyl)methyl]-1H-imidazole-1,2-diyl]bis[phenol], with the CAS number 885268-49-5, is a synthetic organic compound characterized by its complex structure that includes imidazole and phenolic moieties. This compound features a bisphenol framework, which is significant in various chemical applications, particularly in the synthesis of polymers and as a potential pharmaceutical agent. The presence of the chloro and hydroxy groups enhances its reactivity and solubility in organic solvents. Its imidazole ring contributes to its biological activity, making it a candidate for research in medicinal chemistry. The compound's properties, such as melting point, solubility, and stability, are influenced by its molecular structure and functional groups. Additionally, it may exhibit antioxidant or antimicrobial properties, which are common in phenolic compounds. Overall, this substance is of interest in both industrial applications and biological research due to its unique chemical characteristics.
Formula:C22H17ClN2O3
InChI:InChI=1S/C22H17ClN2O3/c23-21-20(13-14-1-7-17(26)8-2-14)24-22(15-3-9-18(27)10-4-15)25(21)16-5-11-19(28)12-6-16/h1-12,26-28H,13H2
InChI key:InChIKey=LMXVCPIUMGYJAU-UHFFFAOYSA-N
SMILES:ClC=1N(C(=NC1CC2=CC=C(O)C=C2)C3=CC=C(O)C=C3)C4=CC=C(O)C=C4
Synonyms:
  • Phenol, 4,4′-[5-chloro-4-[(4-hydroxyphenyl)methyl]-1H-imidazole-1,2-diyl]bis-
  • 4,4′-[5-Chloro-4-[(4-hydroxyphenyl)methyl]-1H-imidazole-1,2-diyl]bis[phenol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.