CAS 885268-71-3

8-Chloro-1,2,3,4-tetrahydro-4-isoquinolineethanol

Description:

8-Chloro-1,2,3,4-tetrahydro-4-isoquinolineethanol is a chemical compound characterized by its isoquinoline structure, which features a bicyclic system containing a nitrogen atom. The presence of a chloro substituent at the 8-position and a hydroxyl group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the hydroxyl group. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display specific pharmacological properties, although detailed studies would be necessary to elucidate its mechanism of action and therapeutic potential. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which can influence its behavior in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogen substituents.

Formula: C₁₁H₁₄ClNO

InChI: InChI=1S/C11H14ClNO/c12-11-3-1-2-9-8(4-5-14)6-13-7-10(9)11/h1-3,8,13-14H,4-7H2

InChI key: InChIKey=NDSTTYGLXFFSBY-UHFFFAOYSA-N

SMILES: C(CO)C1C=2C(=C(Cl)C=CC2)CNC1

Synonyms:

• 8-Chloro-1,2,3,4-tetrahydro-4-isoquinolineethanol
• 4-Isoquinolineethanol, 8-chloro-1,2,3,4-tetrahydro-