CAS 885268-80-4

1-[[[4-(2-Methylphenoxy)phenyl]sulfonyl]amino]cyclohexanecarboxylic acid

Description:

1-[[[4-(2-Methylphenoxy)phenyl]sulfonyl]amino]cyclohexanecarboxylic acid, identified by its CAS number 885268-80-4, is a synthetic organic compound characterized by its complex molecular structure, which includes a cyclohexanecarboxylic acid moiety linked to a sulfonamide group. This compound features a phenyl ring substituted with a 2-methylphenoxy group, contributing to its hydrophobic characteristics. The sulfonamide functional group enhances its potential for biological activity, often associated with pharmaceuticals. The presence of the carboxylic acid group suggests that it can participate in acid-base reactions, potentially forming salts or esters. Additionally, the compound's structure may allow for various interactions, such as hydrogen bonding and π-π stacking, which can influence its solubility and reactivity. Overall, this compound's unique structural features may render it of interest in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.

Formula: C₂₀H₂₃NO₅S

InChI: InChI=1S/C20H23NO5S/c1-15-7-3-4-8-18(15)26-16-9-11-17(12-10-16)27(24,25)21-20(19(22)23)13-5-2-6-14-20/h3-4,7-12,21H,2,5-6,13-14H2,1H3,(H,22,23)

InChI key: InChIKey=SLVDFVKLVVTVSA-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=C(OC2=C(C)C=CC=C2)C=C1)C3(C(O)=O)CCCCC3

Synonyms:

• Cyclohexanecarboxylic acid, 1-[[[4-(2-methylphenoxy)phenyl]sulfonyl]amino]-
• 1-[[[4-(2-Methylphenoxy)phenyl]sulfonyl]amino]cyclohexanecarboxylic acid

1-((4-(o-tolyloxy)phenyl)sulfonamido)cyclohexane-1-carboxylic acid

CAS: 885268-80-4

Purity: 95.0%

Molecular weight: 389.4700012207031

Ref: 10-F512265