CymitQuimica logo

CAS 885268-99-5

:

4-Aminothieno[2,3-d]pyrimidine-6-propanamide

Description:
4-Aminothieno[2,3-d]pyrimidine-6-propanamide is a heterocyclic organic compound characterized by its unique structure, which includes a thieno[2,3-d]pyrimidine core with an amino group and a propanamide side chain. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the amine and amide functional groups. The compound may exhibit basic properties due to the amino group, allowing it to participate in hydrogen bonding and interact with biological targets. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The presence of the thieno and pyrimidine moieties may also impart specific electronic and steric properties, influencing its reactivity and interaction with other molecules. As with many heterocycles, it may be subject to various synthetic routes for its preparation and modification.
Formula:C9H10N4OS
InChI:InChI=1S/C9H10N4OS/c10-7(14)2-1-5-3-6-8(11)12-4-13-9(6)15-5/h3-4H,1-2H2,(H2,10,14)(H2,11,12,13)
InChI key:InChIKey=JNXVZNSDGXNJMX-UHFFFAOYSA-N
SMILES:NC1=C2C(SC(CCC(N)=O)=C2)=NC=N1
Synonyms:
  • 4-Aminothieno[2,3-d]pyrimidine-6-propanamide
  • Thieno[2,3-d]pyrimidine-6-propanamide, 4-amino-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.