CymitQuimica logo

CAS 885269-04-5

:

6-(Bromomethyl)thieno[2,3-d]pyrimidin-4-amine

Description:
6-(Bromomethyl)thieno[2,3-d]pyrimidin-4-amine is a heterocyclic compound characterized by the presence of a thieno[2,3-d]pyrimidine core, which incorporates both sulfur and nitrogen atoms in its structure. The compound features a bromomethyl group at the 6-position and an amino group at the 4-position, contributing to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its unique structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. The presence of the bromomethyl group can facilitate further chemical modifications, enhancing its utility in synthetic chemistry. Additionally, the thieno[2,3-d]pyrimidine framework is known for its biological activity, which may include antimicrobial or anticancer properties. As with many chemical substances, safety data should be consulted to understand its handling and toxicity profiles.
Formula:C7H6BrN3S
InChI:InChI=1S/C7H6BrN3S/c8-2-4-1-5-6(9)10-3-11-7(5)12-4/h1,3H,2H2,(H2,9,10,11)
InChI key:InChIKey=XJZYVNIDHQCRFD-UHFFFAOYSA-N
SMILES:NC1=C2C(SC(CBr)=C2)=NC=N1
Synonyms:
  • 6-(Bromomethyl)thieno[2,3-d]pyrimidin-4-amine
  • Thieno[2,3-d]pyrimidin-4-amine, 6-(bromomethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.