CymitQuimica logo

CAS 885269-14-7

:

5′-Chloro-2′,3′-dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline]

Description:
5′-Chloro-2′,3′-dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline] is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopropane ring with an isoquinoline moiety. The presence of a chlorine atom at the 5′ position contributes to its reactivity and potential biological activity. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that can influence its stability and interactions. The spiro arrangement allows for a three-dimensional conformation that may affect its pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 885269-14-7, serves as a unique identifier for regulatory and research purposes. The compound may exhibit various properties such as solubility, melting point, and spectral characteristics, which are essential for understanding its behavior in different environments. Overall, the structural features of this compound suggest potential applications in drug development and materials science, warranting further investigation into its chemical and biological properties.
Formula:C11H12ClN
InChI:InChI=1S/C11H12ClN/c12-9-3-1-2-8-6-13-7-11(4-5-11)10(8)9/h1-3,13H,4-7H2
InChI key:InChIKey=NBYSFQXREUCXBL-UHFFFAOYSA-N
SMILES:ClC1=C2C3(CC3)CNCC2=CC=C1
Synonyms:
  • 5′-Chloro-2′,3′-dihydrospiro[cyclopropane-1,4′(1′H)-isoquinoline]
  • Spiro[cyclopropane-1,4′(1′H)-isoquinoline], 5′-chloro-2′,3′-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.