CAS 885269-43-2
:7′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline]
Description:
7′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline] is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopentane ring with an isoquinoline moiety. The presence of a bromine atom at the 7′ position contributes to its reactivity and potential applications in medicinal chemistry. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that can influence its stability and reactivity. The spiro arrangement allows for interesting conformational properties, which may affect its biological activity. Typically, compounds of this nature are investigated for their potential pharmacological properties, including antitumor or antimicrobial activities. The specific interactions of this compound with biological targets would depend on its structural features, including the bromine substituent and the overall three-dimensional conformation. As with many organic compounds, its solubility, melting point, and other physical properties would be essential for understanding its behavior in various chemical environments.
Formula:C13H16BrN
InChI:InChI=1S/C13H16BrN/c14-11-3-4-12-10(7-11)8-15-9-13(12)5-1-2-6-13/h3-4,7,15H,1-2,5-6,8-9H2
InChI key:InChIKey=UZRYCUDBNMOKMT-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(C3(CNC2)CCCC3)=CC1
Synonyms:- Spiro[cyclopentane-1,4′(1′H)-isoquinoline], 7′-bromo-2′,3′-dihydro-
- 7′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
7'-Bromo-2',3'-dihydro-1'H-spiro[cyclopentane-1,4'-isoquinoline]
CAS:Formula:C13H16BrNMolecular weight:266.1768
