CAS 885269-44-3

4-[[[(4′-Methoxy[1,1′-biphenyl]-4-yl)sulfonyl]amino]methyl]benzoic acid

Description:

4-[[[(4′-Methoxy[1,1′-biphenyl]-4-yl)sulfonyl]amino]methyl]benzoic acid, identified by its CAS number 885269-44-3, is a chemical compound characterized by its complex structure that includes a benzoic acid moiety, a sulfonamide group, and a methoxy-substituted biphenyl. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and organic synthesis. The presence of the sulfonyl group suggests it may participate in nucleophilic reactions, while the methoxy group can influence its solubility and reactivity. Additionally, the compound's structural features may contribute to its biological activity, which could be of interest in medicinal chemistry. Its molecular interactions, stability, and reactivity would be influenced by the functional groups present, making it a candidate for further study in drug development or as a reagent in organic chemistry. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical research.

Formula: C₂₁H₁₉NO₅S

InChI: InChI=1S/C21H19NO5S/c1-27-19-10-6-16(7-11-19)17-8-12-20(13-9-17)28(25,26)22-14-15-2-4-18(5-3-15)21(23)24/h2-13,22H,14H2,1H3,(H,23,24)

InChI key: InChIKey=QVOYNMQWWYYZBY-UHFFFAOYSA-N

SMILES: S(NCC1=CC=C(C(O)=O)C=C1)(=O)(=O)C2=CC=C(C=C2)C3=CC=C(OC)C=C3

Synonyms:

• 4-[[[(4′-Methoxy[1,1′-biphenyl]-4-yl)sulfonyl]amino]methyl]benzoic acid
• Benzoic acid, 4-[[[(4′-methoxy[1,1′-biphenyl]-4-yl)sulfonyl]amino]methyl]-
• 4-[[[4-(4-methoxyphenyl)phenyl]sulfonylamino]methyl]benzoic acid
• 4-(((4'-Methoxy-[1,1'-biphenyl])-4-sulfonamido)methyl)benzoic acid
• 4-(4'-Methoxy-4-biphenylylsulfonylaMinoMethyl)benzoic acid, 96%

4-(((4'-methoxy-[1,1'-biphenyl])-4-sulfonamido)methyl)benzoic acid

CAS: 885269-44-3

Purity: 95.0%

Molecular weight: 397.45001220703125

Ref: 10-F512293