CymitQuimica logo

CAS 885269-45-4

:

6′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline]

Description:
6′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline] is a chemical compound characterized by its unique spirocyclic structure, which combines a cyclopentane ring with an isoquinoline moiety. The presence of a bromine atom at the 6′ position introduces notable reactivity and influences the compound's physical and chemical properties, such as solubility and stability. This compound is typically synthesized through multi-step organic reactions, often involving cyclization processes. Its structure suggests potential applications in medicinal chemistry, particularly in the development of novel pharmaceuticals, due to the isoquinoline's known biological activity. The dihydro form indicates the presence of reduced double bonds, which can affect the compound's interaction with biological targets. Additionally, the spiro configuration may impart unique conformational characteristics, influencing its binding affinity and selectivity in biological systems. Overall, 6′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline] represents a compound of interest for further research in drug discovery and development.
Formula:C13H16BrN
InChI:InChI=1S/C13H16BrN/c14-11-4-3-10-8-15-9-13(12(10)7-11)5-1-2-6-13/h3-4,7,15H,1-2,5-6,8-9H2
InChI key:InChIKey=LGOBNOMLYSCYOR-UHFFFAOYSA-N
SMILES:BrC=1C=C2C3(CNCC2=CC1)CCCC3
Synonyms:
  • 6′-Bromo-2′,3′-dihydrospiro[cyclopentane-1,4′(1′H)-isoquinoline]
  • Spiro[cyclopentane-1,4′(1′H)-isoquinoline], 6′-bromo-2′,3′-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.