CAS 885269-49-8
:4-Chloro-6-(methylthio)-5-pyrimidinemethanamine
Description:
4-Chloro-6-(methylthio)-5-pyrimidinemethanamine, with the CAS number 885269-49-8, is a chemical compound that belongs to the class of pyrimidine derivatives. It features a pyrimidine ring substituted with a chlorine atom at the 4-position and a methylthio group at the 6-position, along with a methanamine group at the 5-position. This compound is characterized by its potential biological activity, which may include roles in medicinal chemistry or as a building block in the synthesis of other compounds. Its structure suggests it may interact with biological targets, making it of interest in pharmaceutical research. The presence of the chlorine and methylthio groups can influence its solubility, reactivity, and overall pharmacological properties. Additionally, the compound's stability and behavior in various environments can be affected by these substituents. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in laboratory settings.
Formula:C6H8ClN3S
InChI:InChI=1S/C6H8ClN3S/c1-11-6-4(2-8)5(7)9-3-10-6/h3H,2,8H2,1H3
InChI key:InChIKey=AEGUYPOBNBUBFX-UHFFFAOYSA-N
SMILES:S(C)C=1C(CN)=C(Cl)N=CN1
Synonyms:- 5-Pyrimidinemethanamine, 4-chloro-6-(methylthio)-
- 4-Chloro-6-(methylthio)-5-pyrimidinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
