CAS 885269-53-4
:6-Fluoro-1,2,3,4-tetrahydro-2-naphthaleneacetic acid
Description:
6-Fluoro-1,2,3,4-tetrahydro-2-naphthaleneacetic acid is a chemical compound characterized by its unique structure, which includes a naphthalene ring system and a tetrahydro configuration. The presence of a fluorine atom at the 6-position of the naphthalene ring contributes to its chemical reactivity and potential biological activity. This compound is classified as a carboxylic acid due to the presence of the acetic acid functional group, which imparts acidic properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its CAS number, 885269-53-4, allows for precise identification and retrieval of information regarding its properties, synthesis, and applications in scientific literature. Overall, 6-Fluoro-1,2,3,4-tetrahydro-2-naphthaleneacetic acid represents a compound of interest in both research and industrial contexts.
Formula:C12H13FO2
InChI:InChI=1S/C12H13FO2/c13-11-4-3-9-5-8(6-12(14)15)1-2-10(9)7-11/h3-4,7-8H,1-2,5-6H2,(H,14,15)
InChI key:InChIKey=JJRFXMTURKSVLL-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1CC=2C(CC1)=CC(F)=CC2
Synonyms:- (6-Fluoro-1,2,3,4-Tetrahydro-Naphthalen-2-Yl)-Acetic Acid
- 2-Naphthaleneacetic acid, 6-fluoro-1,2,3,4-tetrahydro-
- 6-Fluoro-1,2,3,4-tetrahydro-2-naphthaleneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(6-Fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid
CAS:Formula:C12H13FO2Molecular weight:208.22882-(6-Fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid
CAS:<p>2-(6-Fluoro-1,2,3,4-tetrahydronaphthalen-2-yl)acetic acid</p>Molecular weight:208.22882g/mol


