CAS 885269-54-5

1-[[(2,3,5,6-Tetramethylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid

Description:

1-[[(2,3,5,6-Tetramethylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid, with the CAS number 885269-54-5, is a chemical compound characterized by its complex structure that includes a cyclohexanecarboxylic acid moiety and a sulfonamide group. This compound features a sulfonyl group attached to an amino group, which is further linked to a cyclohexane ring that bears a carboxylic acid functional group. The presence of the tetramethylphenyl substituent contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The sulfonamide functional group is known for its biological activity, often serving as a pharmacophore in medicinal chemistry. This compound may exhibit properties such as moderate to high melting points and specific solubility profiles in various solvents, depending on the presence of polar and nonpolar groups. Its unique structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis, although specific biological activities or applications would require further investigation.

Formula: C₁₇H₂₅NO₄S

InChI: InChI=1S/C17H25NO4S/c1-11-10-12(2)14(4)15(13(11)3)23(21,22)18-17(16(19)20)8-6-5-7-9-17/h10,18H,5-9H2,1-4H3,(H,19,20)

InChI key: InChIKey=AUJXKRTUDQFEGI-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=C(C)C(C)=CC(C)=C1C)C2(C(O)=O)CCCCC2

Synonyms:

• 1-[[(2,3,5,6-Tetramethylphenyl)sulfonyl]amino]cyclohexanecarboxylic acid
• Cyclohexanecarboxylic acid, 1-[[(2,3,5,6-tetramethylphenyl)sulfonyl]amino]-

1-((2,3,5,6-tetramethylphenyl)sulfonamido)cyclohexane-1-carboxylic acid

CAS: 885269-54-5

Formula: C₁₇H₂₅NO₄S

Purity: 95.0%

Molecular weight: 339.45

Ref: 10-F512297