CymitQuimica logo

CAS 885269-67-0

:

2-(1,3-Dihydro-2H-inden-2-ylidene)acetic acid

Description:
2-(1,3-Dihydro-2H-inden-2-ylidene)acetic acid, identified by its CAS number 885269-67-0, is an organic compound characterized by its unique bicyclic structure, which includes an indene moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the indene structure imparts potential aromatic characteristics, influencing its reactivity and interactions with other chemical species. Typically, compounds like this may exhibit moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. The compound may also demonstrate interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its synthesis and reactivity can be influenced by the presence of the double bond in the indene structure, which may participate in various chemical reactions, such as electrophilic additions or polymerizations. Overall, 2-(1,3-Dihydro-2H-inden-2-ylidene)acetic acid represents a versatile compound with potential applications in various fields of chemistry and materials science.
Formula:C11H10O2
InChI:InChI=1S/C11H10O2/c12-11(13)7-8-5-9-3-1-2-4-10(9)6-8/h1-4,7H,5-6H2,(H,12,13)
InChI key:InChIKey=QZOQJTCXVPYKRI-UHFFFAOYSA-N
SMILES:C(C(O)=O)=C1CC=2C(C1)=CC=CC2
Synonyms:
  • 2-(1,3-Dihydro-2H-inden-2-ylidene)acetic acid
  • Acetic acid, 2-(1,3-dihydro-2H-inden-2-ylidene)-
  • Acetic acid, (1,3-dihydro-2H-inden-2-ylidene)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.