CAS 885269-70-5
:Carbamic acid, [4-(bromoacetyl)phenyl]-, 1,1-dimethylethyl ester
Description:
Carbamic acid, [4-(bromoacetyl)phenyl]-, 1,1-dimethylethyl ester, identified by CAS number 885269-70-5, is an organic compound characterized by its carbamate functional group. This compound features a phenyl ring substituted with a bromoacetyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl ester group enhances its stability and solubility in organic solvents, making it suitable for various chemical reactions. The bromoacetyl moiety can serve as a reactive site for nucleophilic substitution, allowing for further functionalization. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure suggests potential uses in agrochemicals or as intermediates in the synthesis of more complex molecules. As with many carbamates, it is essential to handle this compound with care due to potential toxicity and environmental considerations. Overall, this compound exemplifies the diverse chemistry associated with carbamates and their derivatives.
Formula:C13H16BrNO3
InChI:InChI=1S/C13H16BrNO3/c1-13(2,3)18-12(17)15-10-6-4-9(5-7-10)11(16)8-14/h4-7H,8H2,1-3H3,(H,15,17)
InChI key:InChIKey=MNEQGZINEZEYDO-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=CC=C(NC(OC(C)(C)C)=O)C=C1
Synonyms:- Carbamic acid, [4-(bromoacetyl)phenyl]-, 1,1-dimethylethyl ester
- N-Boc-4-(2-Bromo-acetyl)-aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
