CAS 885269-80-7

3-[[(3-Fluorophenyl)sulfonyl]amino]benzoic acid

Description:

3-[[(3-Fluorophenyl)sulfonyl]amino]benzoic acid, identified by its CAS number 885269-80-7, is a chemical compound characterized by its sulfonamide functional group and a carboxylic acid moiety. This compound features a benzoic acid core substituted with an amino group and a sulfonyl group attached to a fluorophenyl ring. The presence of the fluorine atom enhances its electronic properties, potentially influencing its reactivity and biological activity. The sulfonamide group is known for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can exhibit antibacterial and anti-inflammatory properties. The compound's solubility, stability, and interaction with biological targets can be influenced by its structural features, making it of interest in drug design and development. Additionally, the specific arrangement of functional groups may affect its pharmacokinetics and pharmacodynamics, which are critical for therapeutic efficacy. Overall, this compound represents a class of sulfonamide derivatives that may have significant applications in various fields, including medicinal chemistry and materials science.

Formula: C₁₃H₁₀FNO₄S

InChI: InChI=1S/C13H10FNO4S/c14-10-4-2-6-12(8-10)20(18,19)15-11-5-1-3-9(7-11)13(16)17/h1-8,15H,(H,16,17)

InChI key: InChIKey=NVLPATGVMWNAHA-UHFFFAOYSA-N

SMILES: S(NC1=CC(C(O)=O)=CC=C1)(=O)(=O)C2=CC(F)=CC=C2

Synonyms:

• 3-[[(3-Fluorophenyl)sulfonyl]amino]benzoic acid
• Benzoic acid, 3-[[(3-fluorophenyl)sulfonyl]amino]-
• 3-((3-Fluorophenyl)sulfonamido)benzoic acid

3-((3-fluorophenyl)sulfonamido)benzoic acid

CAS: 885269-80-7

Formula: C₁₃H₁₀FNO₄S

Purity: 95.0%

Molecular weight: 295.28

Ref: 10-F541839