
CAS 885269-94-3
:5-(2-Furanyl)-4,5-dihydro-3-(2-thienyl)-1H-pyrazole-1-carboxamide
Description:
5-(2-Furanyl)-4,5-dihydro-3-(2-thienyl)-1H-pyrazole-1-carboxamide is a chemical compound characterized by its unique structure, which includes a pyrazole ring fused with a furan and a thienyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the pyrazole moiety, which is known for its role in various pharmacological applications. The carboxamide functional group may contribute to its solubility and reactivity, influencing its interactions in biological systems. The presence of both furan and thienyl groups suggests potential for aromatic interactions, which can enhance its stability and reactivity. Additionally, this compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, allowing for its identification and characterization in laboratory settings. Overall, the unique combination of functional groups and heterocycles in this compound may lead to interesting chemical behavior and potential applications in medicinal chemistry.
Formula:C12H11N3O2S
InChI:InChI=1S/C12H11N3O2S/c13-12(16)15-9(10-3-1-5-17-10)7-8(14-15)11-4-2-6-18-11/h1-6,9H,7H2,(H2,13,16)
InChI key:InChIKey=JFVBYMYGCLQILP-UHFFFAOYSA-N
SMILES:C(N)(=O)N1C(CC(=N1)C2=CC=CS2)C3=CC=CO3
Synonyms:- 1H-Pyrazole-1-carboxamide, 5-(2-furanyl)-4,5-dihydro-3-(2-thienyl)-
- 5-(2-Furanyl)-4,5-dihydro-3-(2-thienyl)-1H-pyrazole-1-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-1-carboxamide,5-(2-furanyl)-4,5-dihydro-3-(2-thienyl)-
CAS:Formula:C12H11N3O2SMolecular weight:261.2996
