
CAS 885270-10-0
:4-Methoxy-1-naphthalenecarboximidamide
Description:
4-Methoxy-1-naphthalenecarboximidamide is an organic compound characterized by its naphthalene structure, which features a methoxy group (-OCH3) and a carboximidamide functional group (-C(=NH)NH2) attached to the naphthalene ring. This compound typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in various chemical reactions, including electrophilic substitution. The presence of the methoxy group can influence its solubility and reactivity, often enhancing its lipophilicity. Additionally, the carboximidamide group may impart biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential hydrogen bonding capabilities, which can affect its interactions in biological systems. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 4-Methoxy-1-naphthalenecarboximidamide is a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-15-11-7-6-10(12(13)14)8-4-2-3-5-9(8)11/h2-7H,1H3,(H3,13,14)
InChI key:InChIKey=UHHWXSJEONXKQT-UHFFFAOYSA-N
SMILES:C(=N)(N)C=1C2=C(C(OC)=CC1)C=CC=C2
Synonyms:- 4-Methoxy-1-naphthalenecarboximidamide
- 1-Naphthalenecarboximidamide, 4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
