CAS 885270-26-8

1,1-Dimethylethyl 3-(2-aminophenyl)-1-pyrrolidinecarboxylate

Description:

1,1-Dimethylethyl 3-(2-aminophenyl)-1-pyrrolidinecarboxylate, identified by its CAS number 885270-26-8, is a chemical compound that features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound is characterized by the presence of a dimethyl group attached to a tertiary carbon, contributing to its steric bulk. The 2-aminophenyl group indicates the presence of an amino group attached to a phenyl ring, which can influence the compound's reactivity and potential biological activity. The carboxylate functional group suggests that this compound may exhibit acidic properties and could participate in various chemical reactions, such as esterification or amidation. Its structural features may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Overall, the compound's unique combination of functional groups and ring structure may contribute to its potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis.

Formula: C₁₅H₂₂N₂O₂

InChI: InChI=1S/C15H22N2O2/c1-15(2,3)19-14(18)17-9-8-11(10-17)12-6-4-5-7-13(12)16/h4-7,11H,8-10,16H2,1-3H3

InChI key: InChIKey=USPALRKCCXPLPY-UHFFFAOYSA-N

SMILES: NC1=C(C2CN(C(OC(C)(C)C)=O)CC2)C=CC=C1

Synonyms:

• 1-Pyrrolidinecarboxylic acid, 3-(2-aminophenyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(2-aminophenyl)-1-pyrrolidinecarboxylate

1-Pyrrolidinecarboxylicacid, 3-(2-aminophenyl)-, 1,1-dimethylethyl ester

CAS: 885270-26-8

Formula: C₁₅H₂₂N₂O₂

Molecular weight: 262.3474

Ref: IN-DA00480U