CAS 885270-43-9
:7-Chloro-2-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine
Description:
7-Chloro-2-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine is a chemical compound characterized by its complex structure, which includes a pyrazolo[1,5-a]pyridine core substituted with a chlorine atom and a trifluoromethylphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. The chlorine atom may also contribute to the compound's reactivity and interaction with biological targets. Overall, this compound is likely to be investigated for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to detailed chemical databases.
Formula:C14H8ClF3N2
InChI:InChI=1S/C14H8ClF3N2/c15-13-3-1-2-11-8-12(19-20(11)13)9-4-6-10(7-5-9)14(16,17)18/h1-8H
InChI key:InChIKey=YBVFASDMDTYYRZ-UHFFFAOYSA-N
SMILES:ClC=1N2N=C(C=C2C=CC1)C3=CC=C(C(F)(F)F)C=C3
Synonyms:- 7-Chloro-2-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine
- Pyrazolo[1,5-a]pyridine, 7-chloro-2-[4-(trifluoromethyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Pyrazolo[1,5-a]pyridine,7-chloro-2-[4-(trifluoromethyl)phenyl]-
CAS:Formula:C14H8ClF3N2Molecular weight:296.6749
