CymitQuimica logo

CAS 885270-48-4

:

Benzeneethanamine,N-(4-chlorophenyl)-3-fluoro-

Description:
Benzeneethanamine, N-(4-chlorophenyl)-3-fluoro- is an organic compound characterized by its amine functional group and aromatic structure. It features a benzene ring substituted with a 4-chlorophenyl group and a 3-fluoro group on the ethylamine backbone. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its hydrophobic nature due to the presence of aromatic rings. The presence of halogen substituents, such as chlorine and fluorine, can influence its reactivity and biological activity, often enhancing lipophilicity and potentially affecting pharmacokinetics in medicinal chemistry contexts. The compound may exhibit various properties such as moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may participate in hydrogen bonding due to the amine group, which can affect its solubility and reactivity. As with many amines, it may also exhibit basic properties, allowing it to interact with acids to form salts. Safety and handling precautions should be observed due to potential toxicity associated with amine compounds and halogenated derivatives.
Formula:C14H13ClFN
Synonyms:
  • (4-Chloro-Phenyl)-[2-(3-Fluoro-Phenyl)-Ethyl]-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.