CAS 885270-59-7
:6-Bromo-3,4-dihydro-2H-1-benzothiopyran-3-amine
Description:
6-Bromo-3,4-dihydro-2H-1-benzothiopyran-3-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzothiopyran moiety. This compound features a bromine atom at the 6-position and an amine functional group at the 3-position, contributing to its reactivity and potential biological activity. The presence of the thiopyran ring suggests that it may exhibit properties typical of heterocyclic compounds, such as the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Its molecular structure may also influence its solubility, stability, and interaction with biological targets, making it of interest in medicinal chemistry and drug development. The compound's CAS number, 885270-59-7, allows for easy identification and retrieval of information related to its synthesis, properties, and applications in scientific literature. Overall, 6-Bromo-3,4-dihydro-2H-1-benzothiopyran-3-amine represents a valuable compound for further research in both synthetic and pharmaceutical chemistry.
Formula:C9H10BrNS
InChI:InChI=1S/C9H10BrNS/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-3,8H,4-5,11H2
InChI key:InChIKey=LJWRGYCUPKZNCC-UHFFFAOYSA-N
SMILES:NC1CC=2C(=CC=C(Br)C2)SC1
Synonyms:- 6-Bromo-3,4-dihydro-2H-1-benzothiopyran-3-amine
- 6-Bromo-Thiochroman-3-Ylamine
- 2H-1-Benzothiopyran-3-amine, 6-bromo-3,4-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
