CAS 885270-62-2
:1,1-Dimethylethyl 3-(2-aminoethyl)-1H-indole-2-acetate
Description:
1,1-Dimethylethyl 3-(2-aminoethyl)-1H-indole-2-acetate, identified by its CAS number 885270-62-2, is a chemical compound that features an indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound is characterized by the presence of a dimethyl group at the 1-position of the indole, contributing to its steric properties. The aminoethyl group at the 3-position introduces basic characteristics, allowing for potential interactions with biological systems. The acetate moiety suggests that the compound may exhibit ester-like properties, influencing its solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for biological activity, such as receptor binding or enzyme inhibition. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific functional groups present. Overall, this compound represents a unique combination of structural elements that may have implications in pharmacological research.
Formula:C16H22N2O2
InChI:InChI=1S/C16H22N2O2/c1-16(2,3)20-15(19)10-14-12(8-9-17)11-6-4-5-7-13(11)18-14/h4-7,18H,8-10,17H2,1-3H3
InChI key:InChIKey=VSRGCUTZMGLYOA-UHFFFAOYSA-N
SMILES:C(CN)C=1C=2C(NC1CC(OC(C)(C)C)=O)=CC=CC2
Synonyms:- 1,1-Dimethylethyl 3-(2-aminoethyl)-1H-indole-2-acetate
- 1H-Indole-2-acetic acid, 3-(2-aminoethyl)-, 1,1-dimethylethyl ester
- [3-(2-Amino-Ethyl)-1H-Indol-2-Yl]-Acetic Acid Tert-Butyl Ester
- Tert-Butyl 2-(3-(2-aminoethyl)-1H-indol-2-yl)acetate
- 3-(2-Aminoethyl)-1H-indole-2-acetic acid 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.