CAS 885270-67-7
:7-Amino-1,4-dihydro-3(2H)-isoquinolinone
Description:
7-Amino-1,4-dihydro-3(2H)-isoquinolinone is a chemical compound characterized by its isoquinoline structure, which features a fused bicyclic system. This compound contains an amino group at the 7-position and a dihydroisoquinolinone moiety, contributing to its potential biological activity. It typically appears as a solid and may exhibit solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including anti-inflammatory and analgesic effects. Its molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the presence of the dihydro group may influence its reactivity and stability under different conditions. As with many organic compounds, the specific characteristics such as melting point, boiling point, and spectral properties would depend on the purity and specific conditions of the sample. Overall, 7-Amino-1,4-dihydro-3(2H)-isoquinolinone represents a versatile scaffold in organic synthesis and medicinal chemistry.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c10-8-2-1-6-4-9(12)11-5-7(6)3-8/h1-3H,4-5,10H2,(H,11,12)
InChI key:InChIKey=LLXJPNQWAGNDDN-UHFFFAOYSA-N
SMILES:O=C1CC=2C(=CC(N)=CC2)CN1
Synonyms:- 3(2H)-isoquinolinone, 7-amino-1,4-dihydro-
- 7-Amino-1,4-dihydro-3(2H)-isoquinolinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
