CAS 885270-71-3
:5-Bromo-2H-1-benzopyran-3-carboxylic acid
Description:
5-Bromo-2H-1-benzopyran-3-carboxylic acid is a chemical compound characterized by its unique structure, which includes a benzopyran moiety and a carboxylic acid functional group. The presence of the bromine atom at the 5-position of the benzopyran ring contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and varying solubility in water, influenced by the carboxylic acid group. Its molecular structure allows for potential interactions with biological targets, making it of interest in pharmaceutical research. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 5-Bromo-2H-1-benzopyran-3-carboxylic acid represents a versatile building block in the development of more complex chemical entities.
Formula:C10H7BrO3
InChI:InChI=1S/C10H7BrO3/c11-8-2-1-3-9-7(8)4-6(5-14-9)10(12)13/h1-4H,5H2,(H,12,13)
InChI key:InChIKey=UUSOOXOTWNHCMC-UHFFFAOYSA-N
SMILES:BrC1=C2C(OCC(C(O)=O)=C2)=CC=C1
Synonyms:- 5-Bromo-2H-1-benzopyran-3-carboxylic acid
- 2H-1-Benzopyran-3-carboxylic acid, 5-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
