CymitQuimica logo

CAS 885270-80-4

:

8-Chloro-2H-1-benzopyran-3-carboxylic acid

Description:
8-Chloro-2H-1-benzopyran-3-carboxylic acid is a chemical compound characterized by its benzopyran structure, which consists of a fused benzene and pyran ring. The presence of a chlorine atom at the 8-position and a carboxylic acid group at the 3-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents, which makes it useful in various chemical applications. Its functional groups suggest potential for participation in various chemical reactions, including nucleophilic substitutions and esterifications. The chlorine substituent can influence the compound's electronic properties, potentially enhancing its biological activity. As a carboxylic acid, it can also engage in acid-base reactions. This compound may be of interest in medicinal chemistry and materials science, where its derivatives could exhibit pharmacological properties or serve as intermediates in synthetic pathways. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H7ClO3
InChI:InChI=1S/C10H7ClO3/c11-8-3-1-2-6-4-7(10(12)13)5-14-9(6)8/h1-4H,5H2,(H,12,13)
InChI key:InChIKey=MUCGQLHFTLWZNH-UHFFFAOYSA-N
SMILES:ClC1=C2C(C=C(C(O)=O)CO2)=CC=C1
Synonyms:
  • 8-Chloro-2H-1-benzopyran-3-carboxylic acid
  • 2H-1-Benzopyran-3-carboxylic acid, 8-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.