CAS 885270-90-6
:1,8-Naphthyridine-2-methanamine
Description:
1,8-Naphthyridine-2-methanamine is a heterocyclic organic compound characterized by its naphthyridine structure, which consists of a fused bicyclic ring system containing nitrogen atoms. This compound features an amine functional group, specifically a methanamine moiety, attached to the naphthyridine ring. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in polar solvents, depending on its specific structure and substituents. The presence of nitrogen in the ring contributes to its basicity and potential reactivity, making it of interest in medicinal chemistry and drug development. Compounds like 1,8-naphthyridine derivatives are often investigated for their biological activities, including antimicrobial and anticancer properties. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the presence of the amine group. Its unique structure and functional groups make it a valuable candidate for further research in synthetic and pharmaceutical chemistry.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-6-8-4-3-7-2-1-5-11-9(7)12-8/h1-5H,6,10H2
InChI key:InChIKey=DDWLMWYHIPGAIN-UHFFFAOYSA-N
SMILES:C(N)C1=NC2=C(C=C1)C=CC=N2
Synonyms:- 1,8-Naphthyridine-2-methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
