
CAS 885270-92-8
:2-(1-Piperazinyl)-1,8-naphthyridine
Description:
2-(1-Piperazinyl)-1,8-naphthyridine is a chemical compound characterized by its unique structure, which includes a naphthyridine core substituted with a piperazine moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar organic solvents. It may possess biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting various receptors or enzymes. The presence of the piperazine ring often contributes to its ability to interact with biological systems, potentially enhancing its pharmacological profile. Additionally, the compound may exhibit moderate to high lipophilicity, influencing its absorption and distribution in biological contexts. Its molecular structure allows for various functional group modifications, which can be explored to optimize its efficacy and selectivity in therapeutic applications. Overall, 2-(1-Piperazinyl)-1,8-naphthyridine represents a versatile scaffold in drug discovery, with implications for treating a range of conditions.
Formula:C12H14N4
InChI:InChI=1S/C12H14N4/c1-2-10-3-4-11(15-12(10)14-5-1)16-8-6-13-7-9-16/h1-5,13H,6-9H2
InChI key:InChIKey=UCZSVZZLZDIYMN-UHFFFAOYSA-N
SMILES:C1(=NC2=C(C=C1)C=CC=N2)N3CCNCC3
Synonyms:- 1,8-Naphthyridine, 2-(1-piperazinyl)-
- 2-(1-Piperazinyl)-1,8-naphthyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
