CAS 885270-93-9

1-Phenyl-1H-benzimidazole-2-methanamine

Description:

1-Phenyl-1H-benzimidazole-2-methanamine, with the CAS number 885270-93-9, is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a phenyl group and a methanamine moiety. This compound typically exhibits properties associated with both aromatic and amine functionalities, contributing to its potential applications in pharmaceuticals and organic synthesis. The presence of the benzimidazole ring suggests potential biological activity, as many benzimidazole derivatives are known for their roles as anti-parasitic, anti-cancer, and anti-inflammatory agents. Additionally, the amine group can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a versatile building block in organic chemistry. The compound's solubility, stability, and reactivity can vary depending on the specific conditions and solvents used. Overall, 1-Phenyl-1H-benzimidazole-2-methanamine represents an interesting subject for further research in medicinal chemistry and material science.

Formula: C₁₄H₁₃N₃

InChI: InChI=1S/C14H13N3/c15-10-14-16-12-8-4-5-9-13(12)17(14)11-6-2-1-3-7-11/h1-9H,10,15H2

InChI key: InChIKey=FZSNBLWTDSFDAW-UHFFFAOYSA-N

SMILES: C(N)C=1N(C=2C(N1)=CC=CC2)C3=CC=CC=C3

Synonyms:

• (1-Phenyl-1H-1,3-benzodiazol-2-yl)methanamine
• 1-Phenyl-1H-benzimidazole-2-methanamine
• (1-Phenylbenzimidazol-2-yl)methanamine
• 2-Aminomethyl-1-phenyl-1H-benzoimidazole
• 1H-Benzimidazole-2-methanamine, 1-phenyl-

(1-phenyl-1H-1,3-benzodiazol-2-yl)methanamine

CAS: 885270-93-9

Formula: C₁₄H₁₃N₃

Molecular weight: 223.2731

Ref: IN-DA00484T