CAS 885271-03-4
:8-Bromo-6-chloro-2H-1-benzopyran-3-carboxaldehyde
Description:
8-Bromo-6-chloro-2H-1-benzopyran-3-carboxaldehyde is a chemical compound characterized by its unique structure, which includes a benzopyran core with bromine and chlorine substituents. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of halogens (bromine and chlorine) can influence its chemical behavior, such as enhancing electrophilicity or participating in substitution reactions. The benzopyran moiety is known for its biological activity, often exhibiting properties such as antioxidant or anti-inflammatory effects. The compound's molecular structure suggests it may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Additionally, its specific CAS number, 885271-03-4, allows for precise identification and retrieval of information regarding its properties, safety data, and potential applications in various fields, including materials science and biochemistry. Overall, 8-Bromo-6-chloro-2H-1-benzopyran-3-carboxaldehyde represents a versatile compound with significant potential for research and development.
Formula:C10H6BrClO2
InChI:InChI=1S/C10H6BrClO2/c11-9-3-8(12)2-7-1-6(4-13)5-14-10(7)9/h1-4H,5H2
InChI key:InChIKey=NPOCHWIEQCJRIE-UHFFFAOYSA-N
SMILES:BrC1=C2C(C=C(C=O)CO2)=CC(Cl)=C1
Synonyms:- 8-Bromo-6-Chloro-2H-Chromene-3-Carbaldehyde
- 8-Bromo-6-chloro-2H-1-benzopyran-3-carboxaldehyde
- 2H-1-Benzopyran-3-carboxaldehyde, 8-bromo-6-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
