CAS 885271-08-9
:6-(Phenylmethoxy)-1H-indazole-3-methanamine
Description:
6-(Phenylmethoxy)-1H-indazole-3-methanamine, with the CAS number 885271-08-9, is a chemical compound that belongs to the indazole class of compounds. It features a distinctive indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a phenylmethoxy group enhances its potential for various interactions, making it of interest in medicinal chemistry. This compound may exhibit biological activity, potentially influencing neurotransmitter systems or other cellular pathways, although specific biological properties would depend on empirical studies. Its structure suggests it could be lipophilic, which may affect its solubility and permeability in biological systems. Additionally, the presence of the methanamine functional group may contribute to its reactivity and interaction with other chemical entities. Overall, 6-(Phenylmethoxy)-1H-indazole-3-methanamine represents a compound with potential applications in pharmacology, though further research is necessary to fully elucidate its characteristics and effects.
Formula:C15H15N3O
InChI:InChI=1S/C15H15N3O/c16-9-15-13-7-6-12(8-14(13)17-18-15)19-10-11-4-2-1-3-5-11/h1-8H,9-10,16H2,(H,17,18)
InChI key:InChIKey=MESMKKLRQOQTAH-UHFFFAOYSA-N
SMILES:C(N)C=1C=2C(=CC(OCC3=CC=CC=C3)=CC2)NN1
Synonyms:- 6-(Phenylmethoxy)-1H-indazole-3-methanamine
- C-(6-Benzyloxy-1H-Indazol-3-Yl)-Methylamine
- 1H-Indazole-3-methanamine, 6-(phenylmethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
